About N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride
N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride (PubChem CID 19743110) has the molecular formula C23H33ClN2O2
and a molecular weight of 404.98 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride |
| PubChem CID | 19743110 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride |
| SMILES | COC(C(=O)NCCN(C(C)C)C(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C23H32N2O2.ClH/c1-18(2)25(19(3)4)17-16-24-22(26)23(27-5,20-12-8-6-9-13-20)21-14-10-7-11-15-21;/h6-15,18-19H,16-17H2,1-5H3,(H,24,26);1H |
| InChIKey | SQWLHWBNQRMCBT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride?
The IUPAC name of N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride (CID 19743110) is N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride.
What is the SMILES notation for N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride?
The canonical SMILES for N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride is COC(C(=O)NCCN(C(C)C)C(C)C)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride?
The InChIKey is SQWLHWBNQRMCBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O2.ClH/c1-18(2)25(19(3)4)17-16-24-22(26)23(27-5,20-12-8-6-9-13-20)21-14-10-7-11-15-21;/h6-15,18-19H,16-17H2,1-5H3,(H,24,26);1H.
What are the key properties of N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride?
N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride has a molecular weight of 404.98 g/mol, XLogP of 4.23, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[di(propan-2-yl)amino]ethyl]-2-methoxy-2,2-diphenylacetamide;hydrochloride is sourced from PubChem (CID 19743110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).