C16H16 — CID 19743380
1,2-bis[(E)-prop-1-enyl]naphthalene (PubChem CID 19743380) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1,2-bis[(E)-prop-1-enyl]naphthalene.
| Compound Name | 1,2-bis[(E)-prop-1-enyl]naphthalene |
|---|---|
| PubChem CID | 19743380 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1,2-bis[(E)-prop-1-enyl]naphthalene |
| SMILES | C/C=C/c1ccc2ccccc2c1/C=C/C |
| InChI | InChI=1S/C16H16/c1-3-7-13-11-12-14-9-5-6-10-16(14)15(13)8-4-2/h3-12H,1-2H3/b7-3+,8-4+ |
| InChIKey | JVBQLAQOVBYJJK-FCXRPNKRSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |