About 2-hydroxypentanethioate
2-hydroxypentanethioate (PubChem CID 19743430) has the molecular formula C5H9O2S-
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-hydroxypentanethioate.
Molecular Properties
| Compound Name | 2-hydroxypentanethioate |
| PubChem CID | 19743430 |
| Molecular Formula | C5H9O2S- |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.03 |
| IUPAC Name | 2-hydroxypentanethioate |
| SMILES | CCCC(O)C(=O)[S-] |
| InChI | InChI=1S/C5H10O2S/c1-2-3-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/p-1 |
| InChIKey | PICCHNWCTUUCAQ-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypentanethioate?
The IUPAC name of 2-hydroxypentanethioate (CID 19743430) is 2-hydroxypentanethioate.
What is the SMILES notation for 2-hydroxypentanethioate?
The canonical SMILES for 2-hydroxypentanethioate is CCCC(O)C(=O)[S-].
What is the InChIKey of 2-hydroxypentanethioate?
The InChIKey is PICCHNWCTUUCAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O2S/c1-2-3-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/p-1.
What are the key properties of 2-hydroxypentanethioate?
2-hydroxypentanethioate has a molecular weight of 133.19 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypentanethioate is sourced from PubChem (CID 19743430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).