C8H5BrF4N2O3 — CID 19744225
5-bromo-2-nitro-4-(1,1,2,2-tetrafluoroethoxy)aniline (PubChem CID 19744225) has the molecular formula C8H5BrF4N2O3 and a molecular weight of 333.04 g/mol. Its IUPAC name is 5-bromo-2-nitro-4-(1,1,2,2-tetrafluoroethoxy)aniline.
| Compound Name | 5-bromo-2-nitro-4-(1,1,2,2-tetrafluoroethoxy)aniline |
|---|---|
| PubChem CID | 19744225 |
| Molecular Formula | C8H5BrF4N2O3 |
| Molecular Weight | 333.04 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 5-bromo-2-nitro-4-(1,1,2,2-tetrafluoroethoxy)aniline |
| SMILES | Nc1cc(Br)c(OC(F)(F)C(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5BrF4N2O3/c9-3-1-4(14)5(15(16)17)2-6(3)18-8(12,13)7(10)11/h1-2,7H,14H2 |
| InChIKey | CXSQRHVSIPIOAA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.04 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|