About [5-(1,3-oxazol-5-yl)furan-2-yl]methanol
[5-(1,3-oxazol-5-yl)furan-2-yl]methanol (PubChem CID 19744686) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is [5-(1,3-oxazol-5-yl)furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(1,3-oxazol-5-yl)furan-2-yl]methanol |
| PubChem CID | 19744686 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | [5-(1,3-oxazol-5-yl)furan-2-yl]methanol |
| SMILES | OCc1ccc(-c2cnco2)o1 |
| InChI | InChI=1S/C8H7NO3/c10-4-6-1-2-7(12-6)8-3-9-5-11-8/h1-3,5,10H,4H2 |
| InChIKey | SXYNYXMJTYKKJD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(1,3-oxazol-5-yl)furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,3-oxazol-5-yl)furan-2-yl]methanol?
The IUPAC name of [5-(1,3-oxazol-5-yl)furan-2-yl]methanol (CID 19744686) is [5-(1,3-oxazol-5-yl)furan-2-yl]methanol.
What is the SMILES notation for [5-(1,3-oxazol-5-yl)furan-2-yl]methanol?
The canonical SMILES for [5-(1,3-oxazol-5-yl)furan-2-yl]methanol is OCc1ccc(-c2cnco2)o1.
What is the InChIKey of [5-(1,3-oxazol-5-yl)furan-2-yl]methanol?
The InChIKey is SXYNYXMJTYKKJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c10-4-6-1-2-7(12-6)8-3-9-5-11-8/h1-3,5,10H,4H2.
What are the key properties of [5-(1,3-oxazol-5-yl)furan-2-yl]methanol?
[5-(1,3-oxazol-5-yl)furan-2-yl]methanol has a molecular weight of 165.15 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,3-oxazol-5-yl)furan-2-yl]methanol is sourced from PubChem (CID 19744686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).