C12H16F6O2 — CID 19744946
propyl 5,6,6-trifluoro-2-methylidene-3-(1,2,2-trifluoroethyl)hexanoate (PubChem CID 19744946) has the molecular formula C12H16F6O2 and a molecular weight of 306.25 g/mol. Its IUPAC name is propyl 5,6,6-trifluoro-2-methylidene-3-(1,2,2-trifluoroethyl)hexanoate.
| Compound Name | propyl 5,6,6-trifluoro-2-methylidene-3-(1,2,2-trifluoroethyl)hexanoate |
|---|---|
| PubChem CID | 19744946 |
| Molecular Formula | C12H16F6O2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | propyl 5,6,6-trifluoro-2-methylidene-3-(1,2,2-trifluoroethyl)hexanoate |
| SMILES | C=C(C(=O)OCCC)C(CC(F)C(F)F)C(F)C(F)F |
| InChI | InChI=1S/C12H16F6O2/c1-3-4-20-12(19)6(2)7(9(14)11(17)18)5-8(13)10(15)16/h7-11H,2-5H2,1H3 |
| InChIKey | FWUFQTMNLKNGIU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|