About benzo[k]phenanthridine-6,8-dione
benzo[k]phenanthridine-6,8-dione (PubChem CID 19744958) has the molecular formula C17H9NO2
and a molecular weight of 259.26 g/mol. Its IUPAC name is benzo[k]phenanthridine-6,8-dione.
Molecular Properties
| Compound Name | benzo[k]phenanthridine-6,8-dione |
| PubChem CID | 19744958 |
| Molecular Formula | C17H9NO2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | benzo[k]phenanthridine-6,8-dione |
| SMILES | O=C1N=c2ccccc2=C2C1=CC(=O)c1ccccc12 |
| InChI | InChI=1S/C17H9NO2/c19-15-9-13-16(11-6-2-1-5-10(11)15)12-7-3-4-8-14(12)18-17(13)20/h1-9H |
| InChIKey | NFFRSZOODHPVCT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[k]phenanthridine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[k]phenanthridine-6,8-dione?
The IUPAC name of benzo[k]phenanthridine-6,8-dione (CID 19744958) is benzo[k]phenanthridine-6,8-dione.
What is the SMILES notation for benzo[k]phenanthridine-6,8-dione?
The canonical SMILES for benzo[k]phenanthridine-6,8-dione is O=C1N=c2ccccc2=C2C1=CC(=O)c1ccccc12.
What is the InChIKey of benzo[k]phenanthridine-6,8-dione?
The InChIKey is NFFRSZOODHPVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9NO2/c19-15-9-13-16(11-6-2-1-5-10(11)15)12-7-3-4-8-14(12)18-17(13)20/h1-9H.
What are the key properties of benzo[k]phenanthridine-6,8-dione?
benzo[k]phenanthridine-6,8-dione has a molecular weight of 259.26 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[k]phenanthridine-6,8-dione is sourced from PubChem (CID 19744958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).