C22H22N2O5 — CID 19745013
N-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-ylmethyl)-3-quinolin-5-yloxypropan-1-amine (PubChem CID 19745013) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-ylmethyl)-3-quinolin-5-yloxypropan-1-amine.
| Compound Name | N-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-ylmethyl)-3-quinolin-5-yloxypropan-1-amine |
|---|---|
| PubChem CID | 19745013 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-ylmethyl)-3-quinolin-5-yloxypropan-1-amine |
| SMILES | c1cc(OCCCNCC2COc3cc4c(cc3O2)OCO4)c2cccnc2c1 |
| InChI | InChI=1S/C22H22N2O5/c1-5-17-16(4-2-8-24-17)18(6-1)25-9-3-7-23-12-15-13-26-21-10-19-20(28-14-27-19)11-22(21)29-15/h1-2,4-6,8,10-11,15,23H,3,7,9,12-14H2 |
| InChIKey | BQONHMFVDOTWQJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|