C38H20F12O16 — CID 19745249
4-[2-(3,4-dicarboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phthalic acid (PubChem CID 19745249) has the molecular formula C38H20F12O16 and a molecular weight of 960.54 g/mol. Its IUPAC name is 4-[2-(3,4-dicarboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phthalic acid.
| Compound Name | 4-[2-(3,4-dicarboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phthalic acid |
|---|---|
| PubChem CID | 19745249 |
| Molecular Formula | C38H20F12O16 |
| Molecular Weight | 960.54 g/mol |
| Exact Mass | 960.06 |
| IUPAC Name | 4-[2-(3,4-dicarboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phthalic acid |
| SMILES | O=C(O)c1ccc(C(c2ccc(C(=O)O)c(C(=O)O)c2)(C(F)(F)F)C(F)(F)F)cc1C(=O)O.O=C(O)c1ccc(C(c2ccc(C(=O)O)c(C(=O)O)c2)(C(F)(F)F)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/2C19H10F6O8/c2*20-18(21,22)17(19(23,24)25,7-1-3-9(13(26)27)11(5-7)15(30)31)8-2-4-10(14(28)29)12(6-8)16(32)33/h2*1-6H,(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | BFENJXKQVBKHIG-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.54 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |