About 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane
2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane (PubChem CID 19745405) has the molecular formula C4HF7O2
and a molecular weight of 214.04 g/mol. Its IUPAC name is 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane.
Analyze 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane?
The IUPAC name of 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane (CID 19745405) is 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane.
What is the SMILES notation for 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane?
The canonical SMILES for 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane is FC1(F)OC(C(F)(F)F)C(F)(F)O1.
What is the InChIKey of 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane?
The InChIKey is XCQVENKJAFUHEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF7O2/c5-2(6,7)1-3(8,9)13-4(10,11)12-1/h1H.
What are the key properties of 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane?
2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane has a molecular weight of 214.04 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4,4-tetrafluoro-5-(trifluoromethyl)-1,3-dioxolane is sourced from PubChem (CID 19745405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).