About 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium
2-(diethylamino)ethyl-methylazanide;diphenylalumanylium (PubChem CID 19745446) has the molecular formula C19H27AlN2
and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium |
| PubChem CID | 19745446 |
| Molecular Formula | C19H27AlN2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium |
| SMILES | CCN(CC)CC[N-]C.c1ccc([Al+]c2ccccc2)cc1 |
| InChI | InChI=1S/C7H17N2.2C6H5.Al/c1-4-9(5-2)7-6-8-3;2*1-2-4-6-5-3-1;/h4-7H2,1-3H3;2*1-5H;/q-1;;;+1 |
| InChIKey | WQCLRSLYQAFMNY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium?
The IUPAC name of 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium (CID 19745446) is 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium.
What is the SMILES notation for 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium?
The canonical SMILES for 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium is CCN(CC)CC[N-]C.c1ccc([Al+]c2ccccc2)cc1.
What is the InChIKey of 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium?
The InChIKey is WQCLRSLYQAFMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N2.2C6H5.Al/c1-4-9(5-2)7-6-8-3;2*1-2-4-6-5-3-1;/h4-7H2,1-3H3;2*1-5H;/q-1;;;+1.
What are the key properties of 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium?
2-(diethylamino)ethyl-methylazanide;diphenylalumanylium has a molecular weight of 310.42 g/mol, XLogP of 2.67, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl-methylazanide;diphenylalumanylium is sourced from PubChem (CID 19745446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).