About 1-fluoro-2,2-dinitroethanol
1-fluoro-2,2-dinitroethanol (PubChem CID 19745564) has the molecular formula C2H3FN2O5
and a molecular weight of 154.05 g/mol. Its IUPAC name is 1-fluoro-2,2-dinitroethanol.
Molecular Properties
| Compound Name | 1-fluoro-2,2-dinitroethanol |
| PubChem CID | 19745564 |
| Molecular Formula | C2H3FN2O5 |
| Molecular Weight | 154.05 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 1-fluoro-2,2-dinitroethanol |
| SMILES | O=[N+]([O-])C(C(O)F)[N+](=O)[O-] |
| InChI | InChI=1S/C2H3FN2O5/c3-1(6)2(4(7)8)5(9)10/h1-2,6H |
| InChIKey | XATCTAFIXMMEFY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.05 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2,2-dinitroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,2-dinitroethanol?
The IUPAC name of 1-fluoro-2,2-dinitroethanol (CID 19745564) is 1-fluoro-2,2-dinitroethanol.
What is the SMILES notation for 1-fluoro-2,2-dinitroethanol?
The canonical SMILES for 1-fluoro-2,2-dinitroethanol is O=[N+]([O-])C(C(O)F)[N+](=O)[O-].
What is the InChIKey of 1-fluoro-2,2-dinitroethanol?
The InChIKey is XATCTAFIXMMEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3FN2O5/c3-1(6)2(4(7)8)5(9)10/h1-2,6H.
What are the key properties of 1-fluoro-2,2-dinitroethanol?
1-fluoro-2,2-dinitroethanol has a molecular weight of 154.05 g/mol, XLogP of -0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,2-dinitroethanol is sourced from PubChem (CID 19745564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).