C31H38F3NO — CID 19745636
2-[2,3-difluoro-4-(2-fluoroheptoxy)phenyl]-5-(4-heptylphenyl)pyridine (PubChem CID 19745636) has the molecular formula C31H38F3NO and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(2-fluoroheptoxy)phenyl]-5-(4-heptylphenyl)pyridine.
| Compound Name | 2-[2,3-difluoro-4-(2-fluoroheptoxy)phenyl]-5-(4-heptylphenyl)pyridine |
|---|---|
| PubChem CID | 19745636 |
| Molecular Formula | C31H38F3NO |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 2-[2,3-difluoro-4-(2-fluoroheptoxy)phenyl]-5-(4-heptylphenyl)pyridine |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3ccc(OCC(F)CCCCC)c(F)c3F)nc2)cc1 |
| InChI | InChI=1S/C31H38F3NO/c1-3-5-7-8-10-11-23-13-15-24(16-14-23)25-17-19-28(35-21-25)27-18-20-29(31(34)30(27)33)36-22-26(32)12-9-6-4-2/h13-21,26H,3-12,22H2,1-2H3 |
| InChIKey | ZCRJLUNXXZEIJE-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|