About 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid
2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid (PubChem CID 19745768) has the molecular formula C14H12F2N2O4
and a molecular weight of 310.26 g/mol. Its IUPAC name is 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid |
| PubChem CID | 19745768 |
| Molecular Formula | C14H12F2N2O4 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid |
| SMILES | Cc1cc(C)nc(OC(Oc2c(F)cccc2F)C(=O)O)n1 |
| InChI | InChI=1S/C14H12F2N2O4/c1-7-6-8(2)18-14(17-7)22-13(12(19)20)21-11-9(15)4-3-5-10(11)16/h3-6,13H,1-2H3,(H,19,20) |
| InChIKey | RVSHPBATCOBQLY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid?
The IUPAC name of 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid (CID 19745768) is 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid.
What is the SMILES notation for 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid?
The canonical SMILES for 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid is Cc1cc(C)nc(OC(Oc2c(F)cccc2F)C(=O)O)n1.
What is the InChIKey of 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid?
The InChIKey is RVSHPBATCOBQLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O4/c1-7-6-8(2)18-14(17-7)22-13(12(19)20)21-11-9(15)4-3-5-10(11)16/h3-6,13H,1-2H3,(H,19,20).
What are the key properties of 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid?
2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid has a molecular weight of 310.26 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenoxy)-2-(4,6-dimethylpyrimidin-2-yl)oxyacetic acid is sourced from PubChem (CID 19745768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).