C15H15NO3 — CID 19745950
2-(3,4-dihydroxyphenyl)-N-phenylpropanamide (PubChem CID 19745950) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-N-phenylpropanamide.
| Compound Name | 2-(3,4-dihydroxyphenyl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 19745950 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-N-phenylpropanamide |
| SMILES | CC(C(=O)Nc1ccccc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H15NO3/c1-10(11-7-8-13(17)14(18)9-11)15(19)16-12-5-3-2-4-6-12/h2-10,17-18H,1H3,(H,16,19) |
| InChIKey | QRBHHOVNSNRAQP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|