C6H6N4O2 — CID 19745993
8-methylimidazo[1,2-a][1,3,5]triazine-2,4-dione (PubChem CID 19745993) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is 8-methylimidazo[1,2-a][1,3,5]triazine-2,4-dione.
| Compound Name | 8-methylimidazo[1,2-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 19745993 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 8-methylimidazo[1,2-a][1,3,5]triazine-2,4-dione |
| SMILES | Cn1ccn2c(=O)[nH]c(=O)nc12 |
| InChI | InChI=1S/C6H6N4O2/c1-9-2-3-10-5(9)7-4(11)8-6(10)12/h2-3H,1H3,(H,8,11,12) |
| InChIKey | OCPVCAWJMHZIDT-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |