About N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine
N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine (PubChem CID 19746083) has the molecular formula C17H13N3S
and a molecular weight of 291.38 g/mol. Its IUPAC name is N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine.
Molecular Properties
| Compound Name | N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine |
| PubChem CID | 19746083 |
| Molecular Formula | C17H13N3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine |
| SMILES | C(=N/c1c2c(nc3ccccc13)CSC2)\c1cccnc1 |
| InChI | InChI=1S/C17H13N3S/c1-2-6-15-13(5-1)17(14-10-21-11-16(14)20-15)19-9-12-4-3-7-18-8-12/h1-9H,10-11H2/b19-9+ |
| InChIKey | UDQIKKUACOIRSV-DJKKODMXSA-N |
| XLogP | 4.13 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine?
The IUPAC name of N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine (CID 19746083) is N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine.
What is the SMILES notation for N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine?
The canonical SMILES for N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine is C(=N/c1c2c(nc3ccccc13)CSC2)\c1cccnc1.
What is the InChIKey of N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine?
The InChIKey is UDQIKKUACOIRSV-DJKKODMXSA-N. The full InChI is InChI=1S/C17H13N3S/c1-2-6-15-13(5-1)17(14-10-21-11-16(14)20-15)19-9-12-4-3-7-18-8-12/h1-9H,10-11H2/b19-9+.
What are the key properties of N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine?
N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine has a molecular weight of 291.38 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dihydrothieno[3,4-b]quinolin-9-yl)-1-pyridin-3-ylmethanimine is sourced from PubChem (CID 19746083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).