About N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide
N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide (PubChem CID 19746422) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide.
Molecular Properties
| Compound Name | N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide |
| PubChem CID | 19746422 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide |
| SMILES | CC(=O)Nc1cc2ccc1=2 |
| InChI | InChI=1S/C8H7NO/c1-5(10)9-8-4-6-2-3-7(6)8/h2-4H,1H3,(H,9,10) |
| InChIKey | LBQZJOBHYYVMRZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide?
The IUPAC name of N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide (CID 19746422) is N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide.
What is the SMILES notation for N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide?
The canonical SMILES for N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide is CC(=O)Nc1cc2ccc1=2.
What is the InChIKey of N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide?
The InChIKey is LBQZJOBHYYVMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c1-5(10)9-8-4-6-2-3-7(6)8/h2-4H,1H3,(H,9,10).
What are the key properties of N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide?
N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide has a molecular weight of 133.15 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)acetamide is sourced from PubChem (CID 19746422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).