About 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol
4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol (PubChem CID 19746559) has the molecular formula C27H32O2
and a molecular weight of 388.55 g/mol. Its IUPAC name is 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol.
Molecular Properties
| Compound Name | 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol |
| PubChem CID | 19746559 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1c(O)ccc(C(CC)c2ccc(O)c(CC=C)c2CC=C)c1CC=C |
| InChI | InChI=1S/C27H32O2/c1-6-11-20-22(15-17-26(28)24(20)13-8-3)19(10-5)23-16-18-27(29)25(14-9-4)21(23)12-7-2/h6-9,15-19,28-29H,1-4,10-14H2,5H3 |
| InChIKey | GRHWSALQLGUBRD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol?
The IUPAC name of 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol (CID 19746559) is 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol.
What is the SMILES notation for 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol?
The canonical SMILES for 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol is C=CCc1c(O)ccc(C(CC)c2ccc(O)c(CC=C)c2CC=C)c1CC=C.
What is the InChIKey of 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol?
The InChIKey is GRHWSALQLGUBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32O2/c1-6-11-20-22(15-17-26(28)24(20)13-8-3)19(10-5)23-16-18-27(29)25(14-9-4)21(23)12-7-2/h6-9,15-19,28-29H,1-4,10-14H2,5H3.
What are the key properties of 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol?
4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol has a molecular weight of 388.55 g/mol, XLogP of 6.55, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-hydroxy-2,3-bis(prop-2-enyl)phenyl]propyl]-2,3-bis(prop-2-enyl)phenol is sourced from PubChem (CID 19746559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).