C54H72N6O6 — CID 19746714
(4-tert-butylcyclohexyl) 4-[[4,6-bis[4-(4-tert-butylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 19746714) has the molecular formula C54H72N6O6 and a molecular weight of 901.21 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 4-[[4,6-bis[4-(4-tert-butylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | (4-tert-butylcyclohexyl) 4-[[4,6-bis[4-(4-tert-butylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 19746714 |
| Molecular Formula | C54H72N6O6 |
| Molecular Weight | 901.21 g/mol |
| Exact Mass | 900.55 |
| IUPAC Name | (4-tert-butylcyclohexyl) 4-[[4,6-bis[4-(4-tert-butylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CC(C)(C)C1CCC(OC(=O)c2ccc(Nc3nc(Nc4ccc(C(=O)OC5CCC(C(C)(C)C)CC5)cc4)nc(Nc4ccc(C(=O)OC5CCC(C(C)(C)C)CC5)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C54H72N6O6/c1-52(2,3)37-16-28-43(29-17-37)64-46(61)34-10-22-40(23-11-34)55-49-58-50(56-41-24-12-35(13-25-41)47(62)65-44-30-18-38(19-31-44)53(4,5)6)60-51(59-49)57-42-26-14-36(15-27-42)48(63)66-45-32-20-39(21-33-45)54(7,8)9/h10-15,22-27,37-39,43-45H,16-21,28-33H2,1-9H3,(H3,55,56,57,58,59,60) |
| InChIKey | RQGUTEQJROVNKS-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.21 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|