C33H34N6O6 — CID 19746716
methyl 4-[[4-(4-methoxycarbonylanilino)-6-[4-(1-methylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 19746716) has the molecular formula C33H34N6O6 and a molecular weight of 610.67 g/mol. Its IUPAC name is methyl 4-[[4-(4-methoxycarbonylanilino)-6-[4-(1-methylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-(4-methoxycarbonylanilino)-6-[4-(1-methylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 19746716 |
| Molecular Formula | C33H34N6O6 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | methyl 4-[[4-(4-methoxycarbonylanilino)-6-[4-(1-methylcyclohexyl)oxycarbonylanilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(Nc3ccc(C(=O)OC)cc3)nc(Nc3ccc(C(=O)OC4(C)CCCCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C33H34N6O6/c1-33(19-5-4-6-20-33)45-29(42)23-11-17-26(18-12-23)36-32-38-30(34-24-13-7-21(8-14-24)27(40)43-2)37-31(39-32)35-25-15-9-22(10-16-25)28(41)44-3/h7-18H,4-6,19-20H2,1-3H3,(H3,34,35,36,37,38,39) |
| InChIKey | XWNWTRNGYSJBSQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|