About 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole
2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole (PubChem CID 19746771) has the molecular formula C17H7Cl4F3N2O2
and a molecular weight of 470.06 g/mol. Its IUPAC name is 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole.
Molecular Properties
| Compound Name | 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole |
| PubChem CID | 19746771 |
| Molecular Formula | C17H7Cl4F3N2O2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 467.92 |
| IUPAC Name | 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole |
| SMILES | O=[N+]([O-])c1c(C(F)(F)F)[nH]c(-c2ccc(Cl)c(Cl)c2)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H7Cl4F3N2O2/c18-9-3-1-7(5-11(9)20)13-14(8-2-4-10(19)12(21)6-8)25-16(17(22,23)24)15(13)26(27)28/h1-6,25H |
| InChIKey | LYJOTLBCZPISTE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole?
The IUPAC name of 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole (CID 19746771) is 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole.
What is the SMILES notation for 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole?
The canonical SMILES for 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole is O=[N+]([O-])c1c(C(F)(F)F)[nH]c(-c2ccc(Cl)c(Cl)c2)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole?
The InChIKey is LYJOTLBCZPISTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H7Cl4F3N2O2/c18-9-3-1-7(5-11(9)20)13-14(8-2-4-10(19)12(21)6-8)25-16(17(22,23)24)15(13)26(27)28/h1-6,25H.
What are the key properties of 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole?
2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole has a molecular weight of 470.06 g/mol, XLogP of 7.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(3,4-dichlorophenyl)-4-nitro-5-(trifluoromethyl)-1H-pyrrole is sourced from PubChem (CID 19746771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).