About 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole
2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole (PubChem CID 19747074) has the molecular formula C15H12ClNOS3
and a molecular weight of 353.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole |
| PubChem CID | 19747074 |
| Molecular Formula | C15H12ClNOS3 |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole |
| SMILES | CCOc1ccc2nc(SSc3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C15H12ClNOS3/c1-2-18-11-5-8-13-14(9-11)19-15(17-13)21-20-12-6-3-10(16)4-7-12/h3-9H,2H2,1H3 |
| InChIKey | SKVRAYIFVRTNFE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole?
The IUPAC name of 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole (CID 19747074) is 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole.
What is the SMILES notation for 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole?
The canonical SMILES for 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole is CCOc1ccc2nc(SSc3ccc(Cl)cc3)sc2c1.
What is the InChIKey of 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole?
The InChIKey is SKVRAYIFVRTNFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNOS3/c1-2-18-11-5-8-13-14(9-11)19-15(17-13)21-20-12-6-3-10(16)4-7-12/h3-9H,2H2,1H3.
What are the key properties of 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole?
2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole has a molecular weight of 353.92 g/mol, XLogP of 6.15, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)disulfanyl]-6-ethoxy-1,3-benzothiazole is sourced from PubChem (CID 19747074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).