About 3,4-dimethyl-2,5-di(propan-2-yl)aniline
3,4-dimethyl-2,5-di(propan-2-yl)aniline (PubChem CID 19747078) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,5-di(propan-2-yl)aniline |
| PubChem CID | 19747078 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 3,4-dimethyl-2,5-di(propan-2-yl)aniline |
| SMILES | Cc1c(C(C)C)cc(N)c(C(C)C)c1C |
| InChI | InChI=1S/C14H23N/c1-8(2)12-7-13(15)14(9(3)4)11(6)10(12)5/h7-9H,15H2,1-6H3 |
| InChIKey | CCESWWTVDQTWQW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2,5-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,5-di(propan-2-yl)aniline?
The IUPAC name of 3,4-dimethyl-2,5-di(propan-2-yl)aniline (CID 19747078) is 3,4-dimethyl-2,5-di(propan-2-yl)aniline.
What is the SMILES notation for 3,4-dimethyl-2,5-di(propan-2-yl)aniline?
The canonical SMILES for 3,4-dimethyl-2,5-di(propan-2-yl)aniline is Cc1c(C(C)C)cc(N)c(C(C)C)c1C.
What is the InChIKey of 3,4-dimethyl-2,5-di(propan-2-yl)aniline?
The InChIKey is CCESWWTVDQTWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-8(2)12-7-13(15)14(9(3)4)11(6)10(12)5/h7-9H,15H2,1-6H3.
What are the key properties of 3,4-dimethyl-2,5-di(propan-2-yl)aniline?
3,4-dimethyl-2,5-di(propan-2-yl)aniline has a molecular weight of 205.34 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,5-di(propan-2-yl)aniline is sourced from PubChem (CID 19747078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).