About 2H-2-benzazepine
2H-2-benzazepine (PubChem CID 19747191) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2H-2-benzazepine.
Molecular Properties
| Compound Name | 2H-2-benzazepine |
| PubChem CID | 19747191 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 2H-2-benzazepine |
| SMILES | C1=CNC=c2ccccc2=C1 |
| InChI | InChI=1S/C10H9N/c1-2-5-10-8-11-7-3-6-9(10)4-1/h1-8,11H |
| InChIKey | XUUSYXJGMRQBKQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-2-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-2-benzazepine?
The IUPAC name of 2H-2-benzazepine (CID 19747191) is 2H-2-benzazepine.
What is the SMILES notation for 2H-2-benzazepine?
The canonical SMILES for 2H-2-benzazepine is C1=CNC=c2ccccc2=C1.
What is the InChIKey of 2H-2-benzazepine?
The InChIKey is XUUSYXJGMRQBKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-5-10-8-11-7-3-6-9(10)4-1/h1-8,11H.
What are the key properties of 2H-2-benzazepine?
2H-2-benzazepine has a molecular weight of 143.19 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-2-benzazepine is sourced from PubChem (CID 19747191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).