C29H27N3O3 — CID 19747256
2-[1-(3,4-dimethoxybenzoyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carbonitrile (PubChem CID 19747256) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxybenzoyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carbonitrile.
| Compound Name | 2-[1-(3,4-dimethoxybenzoyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carbonitrile |
|---|---|
| PubChem CID | 19747256 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[1-(3,4-dimethoxybenzoyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carbonitrile |
| SMILES | COc1ccc(C(=O)N2CCC(=C3c4ccc(C#N)cc4CCc4cccnc43)CC2)cc1OC |
| InChI | InChI=1S/C29H27N3O3/c1-34-25-10-8-23(17-26(25)35-2)29(33)32-14-11-20(12-15-32)27-24-9-5-19(18-30)16-22(24)7-6-21-4-3-13-31-28(21)27/h3-5,8-10,13,16-17H,6-7,11-12,14-15H2,1-2H3 |
| InChIKey | CTLCNGNCPNHGKQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |