C21H26N2OS — CID 19747288
2-(1-methylpiperidin-4-yl)-13-methylsulfanyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol (PubChem CID 19747288) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)-13-methylsulfanyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol.
| Compound Name | 2-(1-methylpiperidin-4-yl)-13-methylsulfanyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol |
|---|---|
| PubChem CID | 19747288 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)-13-methylsulfanyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol |
| SMILES | CSc1ccc2c(c1)CCc1cccnc1C2(O)C1CCN(C)CC1 |
| InChI | InChI=1S/C21H26N2OS/c1-23-12-9-17(10-13-23)21(24)19-8-7-18(25-2)14-16(19)6-5-15-4-3-11-22-20(15)21/h3-4,7-8,11,14,17,24H,5-6,9-10,12-13H2,1-2H3 |
| InChIKey | IEHNKRKGULKWOF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |