C23H23N3O2 — CID 19747296
ethyl 4-(13-cyano-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (PubChem CID 19747296) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is ethyl 4-(13-cyano-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(13-cyano-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19747296 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | ethyl 4-(13-cyano-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(C#N)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C23H23N3O2/c1-2-28-23(27)26-12-9-17(10-13-26)21-20-8-5-16(15-24)14-19(20)7-6-18-4-3-11-25-22(18)21/h3-5,8,11,14H,2,6-7,9-10,12-13H2,1H3 |
| InChIKey | GANAVTAKIFLBJO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |