C24H29N3O5S — CID 19747354
[2-[1-(2-aminoacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] propyl sulfate (PubChem CID 19747354) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is [2-[1-(2-aminoacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] propyl sulfate.
| Compound Name | [2-[1-(2-aminoacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] propyl sulfate |
|---|---|
| PubChem CID | 19747354 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | [2-[1-(2-aminoacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] propyl sulfate |
| SMILES | CCCOS(=O)(=O)Oc1ccc2c(c1)CCc1cccnc1C2=C1CCN(C(=O)CN)CC1 |
| InChI | InChI=1S/C24H29N3O5S/c1-2-14-31-33(29,30)32-20-7-8-21-19(15-20)6-5-18-4-3-11-26-24(18)23(21)17-9-12-27(13-10-17)22(28)16-25/h3-4,7-8,11,15H,2,5-6,9-10,12-14,16,25H2,1H3 |
| InChIKey | XXQQNCKGHJBYCX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |