About 6-(2-methylpropoxy)-3,4-dihydroisoquinoline
6-(2-methylpropoxy)-3,4-dihydroisoquinoline (PubChem CID 19748099) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-(2-methylpropoxy)-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-(2-methylpropoxy)-3,4-dihydroisoquinoline |
| PubChem CID | 19748099 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-(2-methylpropoxy)-3,4-dihydroisoquinoline |
| SMILES | CC(C)COc1ccc2c(c1)CCN=C2 |
| InChI | InChI=1S/C13H17NO/c1-10(2)9-15-13-4-3-12-8-14-6-5-11(12)7-13/h3-4,7-8,10H,5-6,9H2,1-2H3 |
| InChIKey | BNDVGUDYJIFWIH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-methylpropoxy)-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylpropoxy)-3,4-dihydroisoquinoline?
The IUPAC name of 6-(2-methylpropoxy)-3,4-dihydroisoquinoline (CID 19748099) is 6-(2-methylpropoxy)-3,4-dihydroisoquinoline.
What is the SMILES notation for 6-(2-methylpropoxy)-3,4-dihydroisoquinoline?
The canonical SMILES for 6-(2-methylpropoxy)-3,4-dihydroisoquinoline is CC(C)COc1ccc2c(c1)CCN=C2.
What is the InChIKey of 6-(2-methylpropoxy)-3,4-dihydroisoquinoline?
The InChIKey is BNDVGUDYJIFWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-10(2)9-15-13-4-3-12-8-14-6-5-11(12)7-13/h3-4,7-8,10H,5-6,9H2,1-2H3.
What are the key properties of 6-(2-methylpropoxy)-3,4-dihydroisoquinoline?
6-(2-methylpropoxy)-3,4-dihydroisoquinoline has a molecular weight of 203.29 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylpropoxy)-3,4-dihydroisoquinoline is sourced from PubChem (CID 19748099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).