C18H22N2O3 — CID 19748108
1,4-dimethoxy-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one (PubChem CID 19748108) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1,4-dimethoxy-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one.
| Compound Name | 1,4-dimethoxy-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
|---|---|
| PubChem CID | 19748108 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1,4-dimethoxy-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
| SMILES | COc1ccc(OC)c2c1CCN1C(=O)C3=C(CC21)NCCC3 |
| InChI | InChI=1S/C18H22N2O3/c1-22-15-5-6-16(23-2)17-12(15)7-9-20-14(17)10-13-11(18(20)21)4-3-8-19-13/h5-6,14,19H,3-4,7-10H2,1-2H3 |
| InChIKey | FMJBAFJFZQZFNL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |