C22H30N2O — CID 19748117
3-hexyl-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one (PubChem CID 19748117) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 3-hexyl-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one.
| Compound Name | 3-hexyl-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
|---|---|
| PubChem CID | 19748117 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 3-hexyl-5,6,9,10,11,12,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
| SMILES | CCCCCCc1ccc2c(c1)CCN1C(=O)C3=C(CC21)NCCC3 |
| InChI | InChI=1S/C22H30N2O/c1-2-3-4-5-7-16-9-10-18-17(14-16)11-13-24-21(18)15-20-19(22(24)25)8-6-12-23-20/h9-10,14,21,23H,2-8,11-13,15H2,1H3 |
| InChIKey | MDHFIRGVGGNUNF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|