C17H18N2O3 — CID 19748138
4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8,15(20)-tetraen-14-one (PubChem CID 19748138) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8,15(20)-tetraen-14-one.
| Compound Name | 4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8,15(20)-tetraen-14-one |
|---|---|
| PubChem CID | 19748138 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4,6-dioxa-13,19-diazapentacyclo[11.8.0.02,10.03,7.015,20]henicosa-2(10),3(7),8,15(20)-tetraen-14-one |
| SMILES | O=C1C2=C(CC3c4c(ccc5c4OCO5)CCN13)NCCC2 |
| InChI | InChI=1S/C17H18N2O3/c20-17-11-2-1-6-18-12(11)8-13-15-10(5-7-19(13)17)3-4-14-16(15)22-9-21-14/h3-4,13,18H,1-2,5-9H2 |
| InChIKey | DXNHAMHWMAMJIB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |