C20H28NO7-3 — CID 19748242
butanedioate;ethane;4-(2-piperidin-4-ylethoxy)benzoate (PubChem CID 19748242) has the molecular formula C20H28NO7-3 and a molecular weight of 394.44 g/mol. Its IUPAC name is butanedioate;ethane;4-(2-piperidin-4-ylethoxy)benzoate.
| Compound Name | butanedioate;ethane;4-(2-piperidin-4-ylethoxy)benzoate |
|---|---|
| PubChem CID | 19748242 |
| Molecular Formula | C20H28NO7-3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | butanedioate;ethane;4-(2-piperidin-4-ylethoxy)benzoate |
| SMILES | CC.O=C([O-])CCC(=O)[O-].O=C([O-])c1ccc(OCCC2CCNCC2)cc1 |
| InChI | InChI=1S/C14H19NO3.C4H6O4.C2H6/c16-14(17)12-1-3-13(4-2-12)18-10-7-11-5-8-15-9-6-11;5-3(6)1-2-4(7)8;1-2/h1-4,11,15H,5-10H2,(H,16,17);1-2H2,(H,5,6)(H,7,8);1-2H3/p-3 |
| InChIKey | OKUCRUMVZHGZJS-UHFFFAOYSA-K |
| XLogP | -0.89 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |