C26H14Cl4O6 — CID 19748330
[4-[4,5,6,7-tetrachloro-3-oxo-1-(4-prop-2-enoyloxyphenyl)-2-benzofuran-1-yl]phenyl] prop-2-enoate (PubChem CID 19748330) has the molecular formula C26H14Cl4O6 and a molecular weight of 564.20 g/mol. Its IUPAC name is [4-[4,5,6,7-tetrachloro-3-oxo-1-(4-prop-2-enoyloxyphenyl)-2-benzofuran-1-yl]phenyl] prop-2-enoate.
| Compound Name | [4-[4,5,6,7-tetrachloro-3-oxo-1-(4-prop-2-enoyloxyphenyl)-2-benzofuran-1-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 19748330 |
| Molecular Formula | C26H14Cl4O6 |
| Molecular Weight | 564.20 g/mol |
| Exact Mass | 561.95 |
| IUPAC Name | [4-[4,5,6,7-tetrachloro-3-oxo-1-(4-prop-2-enoyloxyphenyl)-2-benzofuran-1-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C2(c3ccc(OC(=O)C=C)cc3)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)cc1 |
| InChI | InChI=1S/C26H14Cl4O6/c1-3-17(31)34-15-9-5-13(6-10-15)26(14-7-11-16(12-8-14)35-18(32)4-2)20-19(25(33)36-26)21(27)23(29)24(30)22(20)28/h3-12H,1-2H2 |
| InChIKey | ZKQQGHLGDSPWTO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.20 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|