C28H18Cl4O6 — CID 19748340
[4-[4,5,6,7-tetrachloro-1-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxo-2-benzofuran-1-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 19748340) has the molecular formula C28H18Cl4O6 and a molecular weight of 592.26 g/mol. Its IUPAC name is [4-[4,5,6,7-tetrachloro-1-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxo-2-benzofuran-1-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4,5,6,7-tetrachloro-1-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxo-2-benzofuran-1-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19748340 |
| Molecular Formula | C28H18Cl4O6 |
| Molecular Weight | 592.26 g/mol |
| Exact Mass | 589.99 |
| IUPAC Name | [4-[4,5,6,7-tetrachloro-1-[4-(2-methylprop-2-enoyloxy)phenyl]-3-oxo-2-benzofuran-1-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C2(c3ccc(OC(=O)C(=C)C)cc3)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)cc1 |
| InChI | InChI=1S/C28H18Cl4O6/c1-13(2)25(33)36-17-9-5-15(6-10-17)28(16-7-11-18(12-8-16)37-26(34)14(3)4)20-19(27(35)38-28)21(29)23(31)24(32)22(20)30/h5-12H,1,3H2,2,4H3 |
| InChIKey | KXNBPEHMPXYBJD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.26 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|