About 3-(2,5-dioxopyrrol-1-yl)propyl acetate
3-(2,5-dioxopyrrol-1-yl)propyl acetate (PubChem CID 19748567) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)propyl acetate.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)propyl acetate |
| PubChem CID | 19748567 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)propyl acetate |
| SMILES | CC(=O)OCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO4/c1-7(11)14-6-2-5-10-8(12)3-4-9(10)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | NKEZYLZPRZSLHJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propyl acetate?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propyl acetate (CID 19748567) is 3-(2,5-dioxopyrrol-1-yl)propyl acetate.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)propyl acetate?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)propyl acetate is CC(=O)OCCCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)propyl acetate?
The InChIKey is NKEZYLZPRZSLHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-7(11)14-6-2-5-10-8(12)3-4-9(10)13/h3-4H,2,5-6H2,1H3.
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)propyl acetate?
3-(2,5-dioxopyrrol-1-yl)propyl acetate has a molecular weight of 197.19 g/mol, XLogP of -0.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)propyl acetate is sourced from PubChem (CID 19748567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).