C25H32N2O5 — CID 19748850
(E)-but-2-enedioic acid;N-[(4-phenyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-N-propylpropan-1-amine (PubChem CID 19748850) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[(4-phenyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-N-propylpropan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[(4-phenyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 19748850 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[(4-phenyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CC1CN(c2ccccc2)c2ccccc2O1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H28N2O.C4H4O4/c1-3-14-22(15-4-2)16-19-17-23(18-10-6-5-7-11-18)20-12-8-9-13-21(20)24-19;5-3(6)1-2-4(7)8/h5-13,19H,3-4,14-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HLLJSDTUMVBSIY-WLHGVMLRSA-N |
| XLogP | 4.42 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|