About isocyanatoethane;2-isocyanatopropane
isocyanatoethane;2-isocyanatopropane (PubChem CID 19748904) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is isocyanatoethane;2-isocyanatopropane.
Molecular Properties
| Compound Name | isocyanatoethane;2-isocyanatopropane |
| PubChem CID | 19748904 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | isocyanatoethane;2-isocyanatopropane |
| SMILES | CC(C)N=C=O.CCN=C=O |
| InChI | InChI=1S/C4H7NO.C3H5NO/c1-4(2)5-3-6;1-2-4-3-5/h4H,1-2H3;2H2,1H3 |
| InChIKey | YCONYRSBPRIFIL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanatoethane;2-isocyanatopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanatoethane;2-isocyanatopropane?
The IUPAC name of isocyanatoethane;2-isocyanatopropane (CID 19748904) is isocyanatoethane;2-isocyanatopropane.
What is the SMILES notation for isocyanatoethane;2-isocyanatopropane?
The canonical SMILES for isocyanatoethane;2-isocyanatopropane is CC(C)N=C=O.CCN=C=O.
What is the InChIKey of isocyanatoethane;2-isocyanatopropane?
The InChIKey is YCONYRSBPRIFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C3H5NO/c1-4(2)5-3-6;1-2-4-3-5/h4H,1-2H3;2H2,1H3.
What are the key properties of isocyanatoethane;2-isocyanatopropane?
isocyanatoethane;2-isocyanatopropane has a molecular weight of 156.18 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanatoethane;2-isocyanatopropane is sourced from PubChem (CID 19748904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).