C16H14N2O3 — CID 19748921
2,3-dihydroxy-5,6,13,13a-tetrahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one (PubChem CID 19748921) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2,3-dihydroxy-5,6,13,13a-tetrahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one.
| Compound Name | 2,3-dihydroxy-5,6,13,13a-tetrahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
|---|---|
| PubChem CID | 19748921 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2,3-dihydroxy-5,6,13,13a-tetrahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
| SMILES | O=C1c2cccnc2CC2c3cc(O)c(O)cc3CCN12 |
| InChI | InChI=1S/C16H14N2O3/c19-14-6-9-3-5-18-13(11(9)7-15(14)20)8-12-10(16(18)21)2-1-4-17-12/h1-2,4,6-7,13,19-20H,3,5,8H2 |
| InChIKey | DMKCXGTYFSWZKV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|