About 9-chloro-2,3,7-trimethylacridine
9-chloro-2,3,7-trimethylacridine (PubChem CID 19749386) has the molecular formula C16H14ClN
and a molecular weight of 255.75 g/mol. Its IUPAC name is 9-chloro-2,3,7-trimethylacridine.
Molecular Properties
| Compound Name | 9-chloro-2,3,7-trimethylacridine |
| PubChem CID | 19749386 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 9-chloro-2,3,7-trimethylacridine |
| SMILES | Cc1ccc2nc3cc(C)c(C)cc3c(Cl)c2c1 |
| InChI | InChI=1S/C16H14ClN/c1-9-4-5-14-12(6-9)16(17)13-7-10(2)11(3)8-15(13)18-14/h4-8H,1-3H3 |
| InChIKey | XKEKMFVOIMJEII-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-2,3,7-trimethylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-2,3,7-trimethylacridine?
The IUPAC name of 9-chloro-2,3,7-trimethylacridine (CID 19749386) is 9-chloro-2,3,7-trimethylacridine.
What is the SMILES notation for 9-chloro-2,3,7-trimethylacridine?
The canonical SMILES for 9-chloro-2,3,7-trimethylacridine is Cc1ccc2nc3cc(C)c(C)cc3c(Cl)c2c1.
What is the InChIKey of 9-chloro-2,3,7-trimethylacridine?
The InChIKey is XKEKMFVOIMJEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN/c1-9-4-5-14-12(6-9)16(17)13-7-10(2)11(3)8-15(13)18-14/h4-8H,1-3H3.
What are the key properties of 9-chloro-2,3,7-trimethylacridine?
9-chloro-2,3,7-trimethylacridine has a molecular weight of 255.75 g/mol, XLogP of 4.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-2,3,7-trimethylacridine is sourced from PubChem (CID 19749386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).