C22H25N3O2 — CID 19750712
ethyl 2-[4-[(3-butyl-1H-1,2,4-triazol-5-yl)methyl]phenyl]benzoate (PubChem CID 19750712) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 2-[4-[(3-butyl-1H-1,2,4-triazol-5-yl)methyl]phenyl]benzoate.
| Compound Name | ethyl 2-[4-[(3-butyl-1H-1,2,4-triazol-5-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 19750712 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | ethyl 2-[4-[(3-butyl-1H-1,2,4-triazol-5-yl)methyl]phenyl]benzoate |
| SMILES | CCCCc1n[nH]c(Cc2ccc(-c3ccccc3C(=O)OCC)cc2)n1 |
| InChI | InChI=1S/C22H25N3O2/c1-3-5-10-20-23-21(25-24-20)15-16-11-13-17(14-12-16)18-8-6-7-9-19(18)22(26)27-4-2/h6-9,11-14H,3-5,10,15H2,1-2H3,(H,23,24,25) |
| InChIKey | SRKHOMLGSBLKES-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |