C17H22N2O4 — CID 19750998
1-[6-(2,5-dioxopyrrol-1-yl)-5,6-dimethylheptyl]pyrrole-2,5-dione (PubChem CID 19750998) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[6-(2,5-dioxopyrrol-1-yl)-5,6-dimethylheptyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-(2,5-dioxopyrrol-1-yl)-5,6-dimethylheptyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19750998 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[6-(2,5-dioxopyrrol-1-yl)-5,6-dimethylheptyl]pyrrole-2,5-dione |
| SMILES | CC(CCCCN1C(=O)C=CC1=O)C(C)(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H22N2O4/c1-12(17(2,3)19-15(22)9-10-16(19)23)6-4-5-11-18-13(20)7-8-14(18)21/h7-10,12H,4-6,11H2,1-3H3 |
| InChIKey | ZTOLWEKWKHQZSK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|