About cyclohex-4-ene-1,3-dicarbonitrile
cyclohex-4-ene-1,3-dicarbonitrile (PubChem CID 19751217) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is cyclohex-4-ene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | cyclohex-4-ene-1,3-dicarbonitrile |
| PubChem CID | 19751217 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | cyclohex-4-ene-1,3-dicarbonitrile |
| SMILES | N#CC1C=CCC(C#N)C1 |
| InChI | InChI=1S/C8H8N2/c9-5-7-2-1-3-8(4-7)6-10/h1-2,7-8H,3-4H2 |
| InChIKey | HTBIGCLYZMDCOI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-4-ene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-4-ene-1,3-dicarbonitrile?
The IUPAC name of cyclohex-4-ene-1,3-dicarbonitrile (CID 19751217) is cyclohex-4-ene-1,3-dicarbonitrile.
What is the SMILES notation for cyclohex-4-ene-1,3-dicarbonitrile?
The canonical SMILES for cyclohex-4-ene-1,3-dicarbonitrile is N#CC1C=CCC(C#N)C1.
What is the InChIKey of cyclohex-4-ene-1,3-dicarbonitrile?
The InChIKey is HTBIGCLYZMDCOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c9-5-7-2-1-3-8(4-7)6-10/h1-2,7-8H,3-4H2.
What are the key properties of cyclohex-4-ene-1,3-dicarbonitrile?
cyclohex-4-ene-1,3-dicarbonitrile has a molecular weight of 132.17 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-4-ene-1,3-dicarbonitrile is sourced from PubChem (CID 19751217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).