About 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one
5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one (PubChem CID 19751436) has the molecular formula C17H16O3S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one.
Molecular Properties
| Compound Name | 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one |
| PubChem CID | 19751436 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one |
| SMILES | COc1cc(-c2ccc(C)s2)cc2oc(=O)c(C)c(C)c12 |
| InChI | InChI=1S/C17H16O3S/c1-9-5-6-15(21-9)12-7-13(19-4)16-10(2)11(3)17(18)20-14(16)8-12/h5-8H,1-4H3 |
| InChIKey | PFJISYQSHNHAID-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one?
The IUPAC name of 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one (CID 19751436) is 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one.
What is the SMILES notation for 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one?
The canonical SMILES for 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one is COc1cc(-c2ccc(C)s2)cc2oc(=O)c(C)c(C)c12.
What is the InChIKey of 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one?
The InChIKey is PFJISYQSHNHAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3S/c1-9-5-6-15(21-9)12-7-13(19-4)16-10(2)11(3)17(18)20-14(16)8-12/h5-8H,1-4H3.
What are the key properties of 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one?
5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one has a molecular weight of 300.38 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3,4-dimethyl-7-(5-methylthiophen-2-yl)chromen-2-one is sourced from PubChem (CID 19751436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).