About (E)-2-hydroxynon-4-enoic acid
(E)-2-hydroxynon-4-enoic acid (PubChem CID 19751846) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is (E)-2-hydroxynon-4-enoic acid.
Molecular Properties
| Compound Name | (E)-2-hydroxynon-4-enoic acid |
| PubChem CID | 19751846 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (E)-2-hydroxynon-4-enoic acid |
| SMILES | CCCC/C=C/CC(O)C(=O)O |
| InChI | InChI=1S/C9H16O3/c1-2-3-4-5-6-7-8(10)9(11)12/h5-6,8,10H,2-4,7H2,1H3,(H,11,12)/b6-5+ |
| InChIKey | WHQILIJJORJUBX-AATRIKPKSA-N |
| XLogP | 1.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-hydroxynon-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-hydroxynon-4-enoic acid?
The IUPAC name of (E)-2-hydroxynon-4-enoic acid (CID 19751846) is (E)-2-hydroxynon-4-enoic acid.
What is the SMILES notation for (E)-2-hydroxynon-4-enoic acid?
The canonical SMILES for (E)-2-hydroxynon-4-enoic acid is CCCC/C=C/CC(O)C(=O)O.
What is the InChIKey of (E)-2-hydroxynon-4-enoic acid?
The InChIKey is WHQILIJJORJUBX-AATRIKPKSA-N. The full InChI is InChI=1S/C9H16O3/c1-2-3-4-5-6-7-8(10)9(11)12/h5-6,8,10H,2-4,7H2,1H3,(H,11,12)/b6-5+.
What are the key properties of (E)-2-hydroxynon-4-enoic acid?
(E)-2-hydroxynon-4-enoic acid has a molecular weight of 172.22 g/mol, XLogP of 1.57, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-hydroxynon-4-enoic acid is sourced from PubChem (CID 19751846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).