C15H24O2 — CID 19751857
4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 19751857) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | 4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 19751857 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 4-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | C=CC(C)(O)/C=C/C1=C(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C15H24O2/c1-6-15(5,17)8-7-13-11(2)9-12(16)10-14(13,3)4/h6-8,12,16-17H,1,9-10H2,2-5H3/b8-7+ |
| InChIKey | HXQRIVAUIRBXMR-BQYQJAHWSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|