About 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine
5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 19752) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 19752 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=NCC(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C9H9ClN2O/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8/h1-4,8H,5H2,(H2,11,12) |
| InChIKey | HAHOPPGVHWVBRR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine (CID 19752) is 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine is NC1=NCC(c2ccc(Cl)cc2)O1.
What is the InChIKey of 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is HAHOPPGVHWVBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8/h1-4,8H,5H2,(H2,11,12).
What are the key properties of 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine?
5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 196.64 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 19752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).