About tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane
tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane (PubChem CID 19752496) has the molecular formula C27H37FOS2Si
and a molecular weight of 488.81 g/mol. Its IUPAC name is tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane |
| PubChem CID | 19752496 |
| Molecular Formula | C27H37FOS2Si |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCC/C=C(\F)CC1SCCCS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H37FOS2Si/c1-27(2,3)32(24-15-8-4-9-16-24,25-17-10-5-11-18-25)29-19-12-6-7-14-23(28)22-26-30-20-13-21-31-26/h4-5,8-11,14-18,26H,6-7,12-13,19-22H2,1-3H3/b23-14- |
| InChIKey | CZEPLYCLZQHQPJ-UCQKPKSFSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane (CID 19752496) is tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane is CC(C)(C)[Si](OCCCC/C=C(\F)CC1SCCCS1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane?
The InChIKey is CZEPLYCLZQHQPJ-UCQKPKSFSA-N. The full InChI is InChI=1S/C27H37FOS2Si/c1-27(2,3)32(24-15-8-4-9-16-24,25-17-10-5-11-18-25)29-19-12-6-7-14-23(28)22-26-30-20-13-21-31-26/h4-5,8-11,14-18,26H,6-7,12-13,19-22H2,1-3H3/b23-14-.
What are the key properties of tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane?
tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane has a molecular weight of 488.81 g/mol, XLogP of 7.17, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(Z)-7-(1,3-dithian-2-yl)-6-fluorohept-5-enoxy]-diphenylsilane is sourced from PubChem (CID 19752496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).