C23H29BrN4O3 — CID 19752741
[4-[[(2-bromobenzoyl)-(3,3-dimethylbutan-2-yl)amino]-ethylcarbamoyl]phenyl]urea (PubChem CID 19752741) has the molecular formula C23H29BrN4O3 and a molecular weight of 489.41 g/mol. Its IUPAC name is [4-[[(2-bromobenzoyl)-(3,3-dimethylbutan-2-yl)amino]-ethylcarbamoyl]phenyl]urea.
| Compound Name | [4-[[(2-bromobenzoyl)-(3,3-dimethylbutan-2-yl)amino]-ethylcarbamoyl]phenyl]urea |
|---|---|
| PubChem CID | 19752741 |
| Molecular Formula | C23H29BrN4O3 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [4-[[(2-bromobenzoyl)-(3,3-dimethylbutan-2-yl)amino]-ethylcarbamoyl]phenyl]urea |
| SMILES | CCN(C(=O)c1ccc(NC(N)=O)cc1)N(C(=O)c1ccccc1Br)C(C)C(C)(C)C |
| InChI | InChI=1S/C23H29BrN4O3/c1-6-27(20(29)16-11-13-17(14-12-16)26-22(25)31)28(15(2)23(3,4)5)21(30)18-9-7-8-10-19(18)24/h7-15H,6H2,1-5H3,(H3,25,26,31) |
| InChIKey | OCWVPTAURXQRBK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|